CAS 341-23-1
:4-fluoro-1H-indazole
Description:
4-Fluoro-1H-indazole is an organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring structure containing nitrogen atoms. The presence of a fluorine atom at the 4-position of the indazole ring significantly influences its chemical properties, including its reactivity and potential biological activity. This compound is typically a white to off-white solid and is sparingly soluble in water but more soluble in organic solvents. It exhibits moderate stability under standard conditions but may undergo reactions typical of aromatic compounds, such as electrophilic substitution. 4-Fluoro-1H-indazole is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anticancer properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H5FN2
InChI:InChI=1/C7H5FN2/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H,(H,9,10)
SMILES:c1cc(c2cn[nH]c2c1)F
Synonyms:- 1H-Indazole, 4-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Fluoroindazole
CAS:Formula:C7H5FN2Purity:>98.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:136.134-Fluoro-1H-indazole
CAS:4-Fluoro-1H-indazolePurity:95%Color and Shape:SolidMolecular weight:136.13g/mol4-Fluoro-1H-indazole
CAS:Controlled Product<p>Applications 4-Fluoro-1H-indazole<br></p>Formula:C7H5FN2Color and Shape:NeatMolecular weight:136.134-Fluoro (1H)indazole
CAS:4-Fluoro (1H)indazole is an electrophilic compound with potentiodynamic polarization and affinity for nitrite. This compound has a high electrochemical impedance, which may be due to its high electronegativity. The protonated form of this molecule is known to exist in the gas phase, but not in the liquid phase. 4-Fluoro (1H)indazole can be used as a corrosion inhibitor for metal surfaces. It also has been shown to be an effective inhibitor of nitrosamine formation from amines and nitrites. 4-Fluoro (1H)indazole reacts with hydroxylamine to give the corresponding indazolium salt, which can be used as an electrochemical probe for studying organic solvents such as tetrahydrofuran and chloroform.Formula:C7H5FN2Purity:Min. 95%Molecular weight:136.13 g/mol





