CAS 341-27-5
:3-Fluorosalicylic acid
Description:
3-Fluorosalicylic acid, with the CAS number 341-27-5, is an aromatic compound that features both a fluorine atom and a carboxylic acid group attached to a salicylic acid framework. This compound is characterized by its molecular structure, which includes a hydroxyl group (-OH) and a carboxylic acid group (-COOH) on a benzene ring, along with a fluorine substituent at the meta position relative to the hydroxyl group. The presence of the fluorine atom can influence the compound's acidity, reactivity, and overall chemical behavior. 3-Fluorosalicylic acid is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to its ability to form hydrogen bonds. It is of interest in various fields, including medicinal chemistry and materials science, as it may exhibit unique biological activities or serve as a precursor for the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H5FO3
InChI:InChI=1/C7H5FO3/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,9H,(H,10,11)
SMILES:c1cc(c(c(c1)F)O)C(=O)O
Synonyms:- 3-Fluoro-2-hydroxybenzoicacid
- Benzoic acid, 3-fluoro-2-hydroxy-
- Qvr Bq Cf
- Salicylic acid, 3-fluoro-
- 3-Fluoro-2-Hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Fluoro-2-hydroxybenzoic acid
CAS:Formula:C7H5FO3Purity:98%Color and Shape:SolidMolecular weight:156.11123-Fluoro-2-hydroxybenzoic acid
CAS:3-Fluoro-2-hydroxybenzoic acidFormula:C7H5FO3Purity:97%Color and Shape: solidMolecular weight:156.11g/mol3-Fluorosalicylic Acid
CAS:Formula:C7H5FO3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:156.113-Fluoro-2-hydroxybenzoic acid
CAS:3-Fluoro-2-hydroxybenzoic acid is a molecule that has been synthesized to be used as a contrast agent in magnetic resonance imaging. 3-Fluoro-2-hydroxybenzoic acid is acidic, with a pKa of 2.3. The molecule can exist in two different isomeric forms: the cis and trans form. The cis form has greater stability and photophysical properties than the trans form, so it is the preferred form for use in imaging applications. 3-Fluoro-2-hydroxybenzoic acid binds to vacuoles, sequestered from the cytoplasm, by hydrogen bonds. This compound is taken up by cells through an ATP binding cassette transporter that facilitates passive transport of molecules across cell membranes.Formula:C7H5FO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:156.11 g/mol3-Fluoro-2-hydroxybenzoic acid
CAS:Formula:C7H5FO3Purity:95%Color and Shape:SolidMolecular weight:156.112




