CAS 34104-46-6
:2-[(pyridin-3-ylcarbonyl)amino]ethyl pyridine-3-carboxylate
Description:
2-[(Pyridin-3-ylcarbonyl)amino]ethyl pyridine-3-carboxylate, with the CAS number 34104-46-6, is a chemical compound characterized by its dual pyridine moieties and an amide functional group. This compound features a pyridine ring substituted with a carboxylate group, which contributes to its potential as a ligand in coordination chemistry. The presence of the carbonyl and amino groups indicates that it can participate in hydrogen bonding, enhancing its solubility and reactivity in various solvents. Its structural attributes suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's stability and reactivity can be influenced by the electronic properties of the pyridine rings, making it a subject of interest for further studies in organic synthesis and drug design. Overall, its unique structure and functional groups provide a foundation for exploring its chemical behavior and potential applications in various fields of chemistry.
Formula:C14H13N3O3
InChI:InChI=1/C14H13N3O3/c18-13(11-3-1-5-15-9-11)17-7-8-20-14(19)12-4-2-6-16-10-12/h1-6,9-10H,7-8H2,(H,17,18)
SMILES:c1cc(cnc1)C(=NCCOC(=O)c1cccnc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

