CAS 34108-21-9
:methyl cyclopropylacetate
Description:
Methyl cyclopropylacetate is an organic compound characterized by its unique structure, which includes a cyclopropyl group and an acetate functional group. It is classified as an ester, resulting from the reaction between cyclopropylacetic acid and methanol. This compound typically appears as a colorless liquid with a pleasant, fruity odor, making it of interest in the flavor and fragrance industries. Methyl cyclopropylacetate is known for its relatively low boiling point and moderate solubility in organic solvents, while being less soluble in water. Its chemical properties include reactivity typical of esters, such as hydrolysis in the presence of acids or bases. Additionally, it may undergo various reactions, including transesterification and oxidation. Due to its structural features, methyl cyclopropylacetate can exhibit interesting biological activities, although specific applications may vary. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, methyl cyclopropylacetate is a compound of interest in both synthetic chemistry and industrial applications.
Formula:C6H10O2
InChI:InChI=1/C6H10O2/c1-8-6(7)4-5-2-3-5/h5H,2-4H2,1H3
SMILES:COC(=O)CC1CC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
METHYL 2-CYCLOPROPYLACETATE
CAS:Formula:C6H10O2Purity:98%Color and Shape:LiquidMolecular weight:114.1424Ref: IN-DA00CM6Z
1g73.00€5g161.00€10g201.00€25g365.00€50g701.00€100gTo inquire100mg45.00€250mg49.00€500mg70.00€Methyl 2-cyclopropylacetate
CAS:Methyl 2-cyclopropylacetateFormula:C6H10O2Purity:97%Color and Shape: colourless liquidMolecular weight:114.14g/molMETHYL 2-CYCLOPROPYLACETATE
CAS:Formula:C6H10O2Purity:98%Color and Shape:LiquidMolecular weight:114.144Ref: 10-F386523
1g70.00€5g168.00€10g264.00€25g458.00€50g637.00€100g1,118.00€100mg34.00€250mg43.00€500mg58.00€Methyl 2-cyclopropylacetate
CAS:Methyl 2-cyclopropylacetate is a heterocyclic compound that has anticancer activity. It inhibits the production of inflammatory cytokines, such as IL-8, in mice with colitis. Methyl 2-cyclopropylacetate also has been shown to inhibit the binding of noradrenaline to its receptor in cell cultures and animals with bowel disease. This drug binds to 5-ht1a receptors and inhibits reuptake of serotonin. Methyl 2-cyclopropylacetate is metabolized by CYP2D6 and CYP3A4 enzymes, making it an inhibitor for these two enzymes. The methyl group can be substituted with ethyl formate or an alkynyl group, which are less reactive than nitro groups when exposed to nucleophiles.Formula:C6H10O2Purity:Min. 95%Molecular weight:114.14 g/mol



