CAS 34113-69-4
:4-Chloro-3-hydroxybenzoic acid
Description:
4-Chloro-3-hydroxybenzoic acid, with the CAS number 34113-69-4, is an aromatic carboxylic acid characterized by the presence of a chloro group and a hydroxyl group on a benzoic acid framework. This compound features a chlorine atom at the para position and a hydroxyl group at the meta position relative to the carboxylic acid group. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. The presence of both the hydroxyl and carboxylic acid functional groups contributes to its acidity and reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Proper handling and storage are essential due to its potential reactivity and environmental impact.
Formula:C7H5ClO3
InChI:InChI=1/C7H5ClO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)
SMILES:c1cc(c(cc1C(=O)O)O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-3-hydroxybenzoic acid
CAS:Formula:C7H5ClO3Purity:98%Color and Shape:SolidMolecular weight:172.56584-Chloro-3-hydroxybenzoic acid
CAS:4-Chloro-3-hydroxybenzoic acidFormula:C7H5ClO3Purity:98%Color and Shape: white solidMolecular weight:172.57g/mol4-Chloro-3-hydroxybenzoic acid
CAS:<p>4-Chloro-3-hydroxybenzoic acid (4-CHB) is a reactive compound that can be used for the detection of bacteria. 4-CHB reacts with peroxyl radicals in solution to form a chlorobenzoic acid derivative, which emits light when excited by radiation. 4-CHB is also capable of dehalogenating chlorobenzene, and can be used as a bioluminescent probe for the detection of bacteria. The reactions are efficient at low concentrations and are detectable with an ultraviolet or visible spectrophotometer.</p>Formula:C7H5ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:172.57 g/mol4-Chloro-3-hydroxybenzoic acid
CAS:Formula:C7H5ClO3Purity:98%Color and Shape:Solid, White powderMolecular weight:172.56



