CAS 34128-02-4

Cyanobenzylideneethoxyaniline

Description:

Cyanobenzylideneethoxyaniline, identified by its CAS number 34128-02-4, is an organic compound characterized by its complex structure, which includes a cyanobenzylidene moiety and an ethoxyaniline group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including organic electronics and dye chemistry. It is likely to be a solid at room temperature, with a specific melting point that can vary based on purity and crystalline form. The presence of the cyanide group suggests potential reactivity, particularly in nucleophilic addition reactions, while the ethoxy group may influence solubility and polarity. Additionally, the compound may display interesting optical properties, making it suitable for use in photonic applications. Safety data should be consulted, as compounds containing cyanide groups can pose health risks. Overall, Cyanobenzylideneethoxyaniline represents a unique chemical entity with diverse potential applications in advanced materials science.

Formula: C₁₆H₁₄N₂O

InChI: InChI=1/C16H14N2O/c1-2-19-16-9-7-15(8-10-16)18-12-14-5-3-13(11-17)4-6-14/h3-10,12H,2H2,1H3/b18-12+

Synonyms:

• 4Cyanobenzylidene-4-ethoxyaniline
• 4-{(E)-[(4-ethoxyphenyl)imino]methyl}benzonitrile

4'-Cyanobenzylidene-4-ethoxyaniline

CAS: 34128-02-4

Formula: C₁₆H₁₄N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 250.2952

Ref: IN-DA003L98

4-(((4-Ethoxyphenyl)Imino)Methyl)Benzonitrile

CAS: 34128-02-4

4-(((4-Ethoxyphenyl)Imino)Methyl)Benzonitrile

Purity: 98%

Molecular weight: 250.30g/mol

Ref: 54-OR1011081

4-(((4-Ethoxyphenyl)imino)methyl)benzonitrile

CAS: 34128-02-4

Purity: 97%

Molecular weight: 250.3009949

Ref: 10-F870488