CAS 34132-00-8

Ethanone, 1-tricyclo[2.2.1.02,6]hept-3-yl-

Description:

Ethanone, 1-tricyclo[2.2.1.02,6]hept-3-yl-, also known by its CAS number 34132-00-8, is an organic compound characterized by its unique bicyclic structure. This substance features a tricyclic framework, which contributes to its distinctive chemical properties. The presence of the ethanone functional group indicates that it contains a carbonyl (C=O) group adjacent to an ethyl group, which can influence its reactivity and interactions with other molecules. Typically, compounds with such structures may exhibit interesting physical properties, such as volatility and solubility in organic solvents, while their chemical behavior can include reactivity typical of ketones, such as nucleophilic addition reactions. The tricyclic nature of the compound may also impart rigidity and specific steric effects, which can affect its biological activity and potential applications in fields like medicinal chemistry or materials science. Overall, the unique structural features of this compound make it a subject of interest for further research and exploration in various chemical contexts.

Formula: C₉H₁₂O

InChI: InChI=1S/C9H12O/c1-4(10)8-5-2-6-7(3-5)9(6)8/h5-9H,2-3H2,1H3

InChI key: InChIKey=SRUPJZPLNFIJOB-UHFFFAOYSA-N

SMILES: C(C)(=O)C1C2C3C2CC1C3

Synonyms:

• Tricyclo[2.2.1.02,6]heptane, ethanone deriv.
• Ketone, methyl tricyclo[2.2.1.02,6]hept-3-yl
• 1-(Tricyclo[2.2.1.02,6]heptan-3-yl)ethanone
• 3-Acetylnortricyclane
• Ethanone, 1-tricyclo[2.2.1.02,6]hept-3-yl-

1-{Tricyclo[2.2.1.0,2,6]heptan-3-yl}ethan-1-one

CAS: 34132-00-8

Versatile small molecule scaffold

Formula: C₉H₁₂O

Purity: Min. 95%

Molecular weight: 136.2 g/mol

Ref: 3D-JBA13200