CAS 3414-74-2
:3-[(dimethylamino)methyl]-1H-indol-5-amine
Description:
3-[(Dimethylamino)methyl]-1H-indol-5-amine, with the CAS number 3414-74-2, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a dimethylamino group attached to a methylene bridge, which connects it to the indole moiety. The presence of the amino group at the 5-position of the indole ring contributes to its potential as a biological active compound. It is often studied for its pharmacological properties, including its role in medicinal chemistry and potential applications in drug development. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its reactivity can be influenced by the presence of the amino and dimethylamino groups, making it a candidate for various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C11H15N3
InChI:InChI=1/C11H15N3/c1-14(2)7-8-6-13-11-4-3-9(12)5-10(8)11/h3-6,13H,7,12H2,1-2H3
SMILES:CN(C)Cc1c[nH]c2ccc(cc12)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Aminogramine
CAS:<p>5-Aminogramine is a fine chemical that is used as a versatile building block for the synthesis of complex compounds. 5-Aminoguanidine is an aminoguanidine compound that has been reported to be useful in the synthesis of reagents and speciality chemicals, such as heterocycles, polymers, and pharmaceuticals. 5-Aminoguanidine has been used as a reactant in the preparation of high quality products with various applications. It is also known to be a useful intermediate for reactions involving nucleophiles or electrophiles. Furthermore, it can be used as a scaffold for the synthesis of other compounds.</p>Formula:C11H15N3Purity:Min. 95%Color and Shape:PowderMolecular weight:189.26 g/mol
