CAS 34146-68-4
:8-methoxy-1,2,3,4-tetrahydroisoquinoline
Description:
8-Methoxy-1,2,3,4-tetrahydroisoquinoline is a chemical compound characterized by its tetrahydroisoquinoline structure, which consists of a bicyclic framework featuring a six-membered and a five-membered ring. The presence of a methoxy group (-OCH3) at the 8-position contributes to its unique chemical properties, influencing its reactivity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, reflecting its non-polar characteristics, while its polar methoxy group can engage in hydrogen bonding. 8-Methoxy-1,2,3,4-tetrahydroisoquinoline is of interest in medicinal chemistry due to its potential pharmacological properties, including neuroprotective and anti-inflammatory effects. Its structural similarity to various alkaloids suggests possible interactions with neurotransmitter systems, making it a candidate for further research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-12-10-4-2-3-8-5-6-11-7-9(8)10/h2-4,11H,5-7H2,1H3
SMILES:COc1cccc2CCNCc12
Synonyms:- Isoquinoline, 1,2,3,4-Tetrahydro-8-Methoxy-
- m90103
- 8-methoxy-1,2,3,4-tetrahydroisoquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isoquinoline, 1,2,3,4-tetrahydro-8-methoxy-
CAS:Formula:C10H13NOPurity:95%Color and Shape:SolidMolecular weight:163.21638-Methoxy-1,2,3,4-tetrahydroisoquinoline
CAS:<p>8-Methoxy-1,2,3,4-tetrahydroisoquinoline</p>Purity:95%Molecular weight:163.22g/mol8-Methoxy-1,2,3,4-tetrahydroisoquinoline
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:163.22000122070312Ref: 10-F227956
1gTo inquire2gTo inquire5gTo inquire10gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire8-Methoxy-1,2,3,4-tetrahydroisoquinoline
CAS:<p>8-Methoxy-1,2,3,4-tetrahydroisoquinoline is a heterocyclic compound that can be synthesized from 1,2,3,4-tetrahydroisoquinoline by catalyzed cyclization with butyllithium. This reaction is known as an ortho-lithiation. The scifinder search of this compound shows that it has the following substituents: a chlorine atom and two methoxy groups on the phenyl group.</p>Formula:C10H13NOPurity:Min. 95%Molecular weight:163.22 g/mol



