CymitQuimica logo

CAS 34148-67-9

:

diethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate

Description:
Diethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, with the CAS number 34148-67-9, is a chemical compound that belongs to the class of dihydropyridines, which are known for their role in pharmacology, particularly as calcium channel blockers. This compound features a diethyl ester functional group, contributing to its solubility and reactivity. The presence of a 2-chlorophenyl group enhances its biological activity and may influence its pharmacokinetic properties. The structure includes two carboxylate ester groups, which can participate in various chemical reactions, including hydrolysis and esterification. Dihydropyridines are often characterized by their ability to undergo oxidation to form pyridine derivatives, and they may exhibit significant biological activity, including potential cardiovascular effects. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of substituents. Overall, this compound is of interest in medicinal chemistry and may have applications in drug development.
Formula:C19H22ClNO4
InChI:InChI=1/C19H22ClNO4/c1-5-24-18(22)15-11(3)21-12(4)16(19(23)25-6-2)17(15)13-9-7-8-10-14(13)20/h7-10,17,21H,5-6H2,1-4H3
SMILES:CCOC(=O)C1=C(C)NC(=C(C1c1ccccc1Cl)C(=O)OCC)C
Synonyms:
  • 3,5-Pyridinedicarboxylic acid, 4-(2-chlorophenyl)-1,4-dihydro-2,6-dimethyl-, diethyl ester
  • Diethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.