CAS 34154-81-9

(1S,2S)-2-(diethylamino)-1-phenyl-propan-1-ol

Description:

(1S,2S)-2-(diethylamino)-1-phenyl-propan-1-ol, with the CAS number 34154-81-9, is a chiral organic compound characterized by its specific stereochemistry, indicated by the (1S,2S) configuration. This compound features a propanol backbone with a phenyl group and a diethylamino substituent, contributing to its potential biological activity. It is typically a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its hydrophobic nature due to the presence of the phenyl and diethylamino groups. The compound may exhibit basic properties due to the amine functionality, allowing it to participate in various chemical reactions, including alkylation and acylation. Its chiral nature suggests that it may have different pharmacological effects depending on the stereoisomer, making it of interest in medicinal chemistry. Additionally, the presence of the diethylamino group may enhance its lipophilicity, potentially influencing its absorption and distribution in biological systems. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₃H₂₁NO

InChI: InChI=1/C13H21NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11,13,15H,4-5H2,1-3H3/t11-,13+/m0/s1

rac-syn N,N-Diethyl Norephedrine

Controlled Product

CAS: 34154-81-9

Applications The main basic metabolite of Diethylpropione.
References Banci, F., et al.: Arzneim.-Forsch., 21, 1616 (1971), Mikhailova, D., et al.: Eur. J. Med. Chem., 13, 49 (1978),

Formula: C₁₃H₂₁NO

Color and Shape: Neat

Molecular weight: 207.31

Ref: TR-D444670