CAS 34158-73-1
:Benzaldehyde, 4-bromo-, oxime
Description:
Benzaldehyde, 4-bromo-, oxime is an organic compound characterized by the presence of both a bromine atom and an oxime functional group attached to a benzaldehyde structure. Its molecular formula typically reflects the presence of a bromine substituent on the aromatic ring, which influences its reactivity and physical properties. The oxime functional group, characterized by the structure R1R2C=NOH, indicates that this compound can participate in various chemical reactions, such as condensation and rearrangement reactions. The presence of the bromine atom can enhance the electrophilicity of the aromatic ring, making it more reactive towards nucleophiles. In terms of physical properties, compounds like this often exhibit moderate solubility in organic solvents and may have distinct melting and boiling points influenced by the bromine substituent. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, Benzaldehyde, 4-bromo-, oxime is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C7H6BrNO
InChI:InChI=1S/C7H6BrNO/c8-7-3-1-6(2-4-7)5-9-10/h1-5,10H
InChI key:InChIKey=UIIZGAXKZZRCBN-UHFFFAOYSA-N
SMILES:C(=NO)C1=CC=C(Br)C=C1
Synonyms:- Benzaldehyde, 4-bromo-, oxime
- Benzaldehyde, p-bromo-, oxime
- 4-Bromobenzaldoxime
- p-Bromobenzaldoxime
- 4-Bromobenzaldehyde oxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Bromobenzaldehyde Oxime
CAS:Formula:C7H6BrNOPurity:>95.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:200.044-Bromobenzaldehyde oxime
CAS:4-Bromobenzaldehyde oximePurity:≥95%Color and Shape:SolidMolecular weight:200.03g/mol4-Bromobenzaldehyde oxime
CAS:4-Bromobenzaldehyde oxime is an antibacterial agent that binds to the surface of gram-positive pathogens and inhibits their growth. It has been shown to inhibit the biosynthesis of bacterial cell walls, which may be due to its ability to form a covalent bond with serum albumin. This functional group is also responsible for the antiinflammatory activity 4-Bromobenzaldehyde oxime displays. The carbonyl group on this molecule reacts with abscisic acid (ABA) in a dehydration reaction, producing a chloride and an oxazolidinone.
Formula:C7H6BrNOPurity:Min. 95%Molecular weight:200.03 g/mol


