CAS 34167-66-3

5,6,7,8-tetrahydroimidazo[1,2-a]pyridine

Description:

5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine is a bicyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in its structure can influence its reactivity and solubility, often allowing for interactions with biological targets. Additionally, the compound may exhibit various functional properties, such as being a potential ligand in coordination chemistry or serving as a precursor in organic synthesis. Its CAS number, 34167-66-3, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine is a versatile compound with applications in various fields, including pharmaceuticals and materials science.

Formula: C₇H₁₀N₂

InChI: InChI=1S/C7H10N2/c1-2-5-9-6-4-8-7(9)3-1/h4,6H,1-3,5H2

InChI key: InChIKey=PPRGXYWEHFENBY-UHFFFAOYSA-N

SMILES: C=12N(C=CN1)CCCC2

Synonyms:

• Imidazo[1,2-A]Pyridine, 5,6,7,8-Tetrahydro-
• 5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine
• 34167-66-3
• 5H,6H,7H,8H-IMIDAZO[1,2-A]PYRIDINE
• Imidazo[1,2-a]pyridine, 5,6,7,8-tetrahydro- (8CI,9CI)
• 5,6,7,8-Tetrahydro-imidazo[1,2-a]pyridine

Imidazo[1,2-a]pyridine, 5,6,7,8-tetrahydro- (8CI,9CI)

CAS: 34167-66-3

Formula: C₇H₁₀N₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 122.1677

Ref: IN-DA00CM1L

5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine

CAS: 34167-66-3

5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine

Purity: 95%

Color and Shape: Solid

Molecular weight: 122.17g/mol

Ref: 54-OR480805

5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine

CAS: 34167-66-3

5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine is a nucleophilic imidazole derivative that has antifungal activity. It is synthesized by reacting 2-chloro-5-nitropyridine with 2-chloroimidazole in the presence of a base. The compound was also found to be active against Candida glabrata and Candida krusei. 5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine binds to the pyridine ring of DNA and inhibits the synthesis of RNA and protein. It also has photophysical properties that can be used in assays for chemical structures.

Formula: C₇H₁₀N₂

Purity: Min. 95%

Molecular weight: 122.17 g/mol

Ref: 3D-JBA16766

5,6,7,8-Tetrahydroimidazo[1,2-a]pyridine

CAS: 34167-66-3

Purity: 96%

Molecular weight: 122.1709976

Ref: 10-F621478