CAS 34168-77-9: 6-fluoro-6-deoxy-D-glucose

Description:6-Fluoro-6-deoxy-D-glucose is a synthetic analog of glucose, where the hydroxyl group at the sixth carbon is replaced by a fluorine atom. This modification imparts unique properties to the molecule, making it of interest in various fields, including medicinal chemistry and biochemistry. The presence of the fluorine atom can influence the compound's reactivity and biological activity, potentially affecting its interaction with glucose transporters and enzymes involved in carbohydrate metabolism. As a deoxy sugar, it lacks the hydroxyl group at the sixth position, which can alter its solubility and stability compared to glucose. This compound is often studied for its potential applications in imaging and as a tracer in metabolic studies, particularly in the context of cancer research, where altered glucose metabolism is a hallmark. Additionally, its structural similarity to glucose allows it to be utilized in various biochemical assays and research applications. Overall, 6-fluoro-6-deoxy-D-glucose serves as a valuable tool in understanding glucose metabolism and developing therapeutic strategies.

Formula:C₆H₁₁FO₅

InChI:InChI=1/C6H11FO5/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-6,8-11H,1H2/t2-,3-,4+,5-,6-/m1/s1

Synonyms:
6-deoxy-6-fluoro-D-glucopyranose
6-deoxy-6-fluoro-beta-D-glucopyranose

Found 5 products.

Product data	Purity	Price range	Estimated delivery
6-Deoxy-6-fluoro-D-glucose REF: 7W-GC0658CAS: 34168-77-9	- - -	To inquire	Mon 21 Apr 25
6-Deoxy-6-fluoro-D-glucopyranose REF: 54-PC3739ECAS: 34168-77-9	97%	504.00 €~1,745.00 €	Thu 24 Apr 25
6-Deoxy-6-fluoro-D-glucose REF: 3D-MD04258CAS: 34168-77-9	Min. 95%	190.00 €~2,421.00 €	Mon 28 Apr 25
(3R,4S,5S,6S)-6-(fluoromethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol REF: 10-F753949CAS: 34168-77-9	98%	- - -	Discontinued product
6-Fluoro-6-deoxyglucose REF: 3D-FF69747CAS: 34168-77-9	Min. 95%	- - -	Discontinued product