CAS 34168-77-9
:6-fluoro-6-deoxy-D-glucose
Description:
6-Fluoro-6-deoxy-D-glucose is a synthetic analog of glucose, where the hydroxyl group at the sixth carbon is replaced by a fluorine atom. This modification imparts unique properties to the molecule, making it of interest in various fields, including medicinal chemistry and biochemistry. The presence of the fluorine atom can influence the compound's reactivity and biological activity, potentially affecting its interaction with glucose transporters and enzymes involved in carbohydrate metabolism. As a deoxy sugar, it lacks the hydroxyl group at the sixth position, which can alter its solubility and stability compared to glucose. This compound is often studied for its potential applications in imaging and as a tracer in metabolic studies, particularly in the context of cancer research, where altered glucose metabolism is a hallmark. Additionally, its structural similarity to glucose allows it to be utilized in various biochemical assays and research applications. Overall, 6-fluoro-6-deoxy-D-glucose serves as a valuable tool in understanding glucose metabolism and developing therapeutic strategies.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-6,8-11H,1H2/t2-,3-,4+,5-,6-/m1/s1
Synonyms:- 6-deoxy-6-fluoro-D-glucopyranose
- 6-deoxy-6-fluoro-beta-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Deoxy-6-fluoro-D-glucopyranose
CAS:6-Deoxy-6-fluoro-D-glucopyranoseFormula:C6H11FO5Purity:97%Color and Shape: pale yellow solidMolecular weight:182.15g/mol6-Deoxy-6-fluoro-D-glucose
CAS:6-Deoxy-6-fluoro-D-glucose is a molecule that belongs to the group of glucose analogs. It has been shown that 6-deoxy-6-fluoro-D-glucose, or dF6G, induces apoptosis in MCF7 cells through inhibition of glut1, the rate limiting enzyme for glycolysis. The structural analysis of the compound showed that it contains a fluorine atom at C2 and an oxygen atom at C3. The kinetic studies revealed that dF6G reacts with H2O in a 1:1 stoichiometric ratio to form hydrogen fluoride and 6-deoxyhexoate. 6dF6G has been shown to have pharmacokinetic properties similar to glucose and it can be used as an alternative source of energy by many organisms including aerobacter aerogenes.
Formula:C6H11FO5Purity:Min. 95%Color and Shape:White PowderMolecular weight:182.15 g/mol




