CAS 34171-69-2

Potassium tricyanomethanide

Description:

Potassium tricyanomethanide, with the CAS number 34171-69-2, is an inorganic compound characterized by its unique structure and properties. It consists of potassium ions (K+) and tricyanomethanide anions (C(CN)3−), where the anion features three cyano (−CN) groups attached to a central carbon atom. This compound is typically a white to light yellow solid and is known for its high stability and solubility in polar solvents. Potassium tricyanomethanide exhibits interesting chemical behavior, particularly in coordination chemistry, where it can form complexes with various metal ions. Its applications may extend to areas such as organic synthesis, materials science, and potentially in the development of electronic materials due to its unique electronic properties. Additionally, the presence of cyano groups imparts notable reactivity, allowing for further derivatization and functionalization in synthetic pathways. As with many cyanide-containing compounds, safety precautions should be observed due to the toxicity associated with cyanide groups.

Formula: C₄KN₃

InChI: InChI=1/C4N3.K/c5-1-4(2-6)3-7;/q-1;+1

SMILES: C(#N)C(=C=[NH-])C#N.K

Synonyms:

• Potassium (Dicyanoethenylidene)Azanide

Potassium Tricyanomethanide

CAS: 34171-69-2

Formula: C₄KN₃

Purity: >98.0%(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 129.16

Ref: 3B-P2538

Potassium tricyanomethanide, min. 98%

CAS: 34171-69-2

Potassium tricyanomethanide, min. 98%

Formula: KC(CN)₃

Purity: min. 98%

Color and Shape: off-white to beige pwdr.

Molecular weight: 129.16

Ref: 08-06-1700

Potassium tricyanomethanide

CAS: 34171-69-2

Formula: C₄KN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 129.1612

Ref: IN-DA003TXN

Potassium Tricyanomethanide

Controlled Product

CAS: 34171-69-2

Formula: C₄N₃·K

Color and Shape: Neat

Molecular weight: 129.161

Ref: TR-P698608

Potassium tricyanomethanide

CAS: 34171-69-2

Potassium tricyanomethanide is a precursor used for the preparation of dicyano ketene aminals. It reacts with amines to prepare alkyl ammonium tricyanomethanide. Further, it is involved in the preparation of tricyanomethanide-bridged binuclear organometallic complexes such as Cp(dppe)FeC(CN)3 and Cp

Formula: C₄KN₃

Molecular weight: 129.16

Ref: 02-020702