CAS 34171-69-2
:Potassium tricyanomethanide
Description:
Potassium tricyanomethanide, with the CAS number 34171-69-2, is an inorganic compound characterized by its unique structure and properties. It consists of potassium ions (K+) and tricyanomethanide anions (C(CN)3−), where the anion features three cyano (−CN) groups attached to a central carbon atom. This compound is typically a white to light yellow solid and is known for its high stability and solubility in polar solvents. Potassium tricyanomethanide exhibits interesting chemical behavior, particularly in coordination chemistry, where it can form complexes with various metal ions. Its applications may extend to areas such as organic synthesis, materials science, and potentially in the development of electronic materials due to its unique electronic properties. Additionally, the presence of cyano groups imparts notable reactivity, allowing for further derivatization and functionalization in synthetic pathways. As with many cyanide-containing compounds, safety precautions should be observed due to the toxicity associated with cyanide groups.
Formula:C4KN3
InChI:InChI=1/C4N3.K/c5-1-4(2-6)3-7;/q-1;+1
SMILES:C(#N)C(=C=[NH-])C#N.K
Synonyms:- Potassium (Dicyanoethenylidene)Azanide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Potassium Tricyanomethanide
CAS:Formula:C4KN3Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:129.16Potassium tricyanomethanide
CAS:Potassium tricyanomethanide is a precursor used for the preparation of dicyano ketene aminals. It reacts with amines to prepare alkyl ammonium tricyanomethanide. Further, it is involved in the preparation of tricyanomethanide-bridged binuclear organometallic complexes such as Cp(dppe)FeC(CN)3 and CpFormula:C4KN3Molecular weight:129.16Potassium tricyanomethanide, min. 98%
CAS:Potassium tricyanomethanide, min. 98%
Formula:KC(CN)3Purity:min. 98%Color and Shape:off-white to beige pwdr.Molecular weight:129.16Potassium tricyanomethanide
CAS:Formula:C4KN3Purity:97%Color and Shape:SolidMolecular weight:129.1612Potassium Tricyanomethanide
CAS:Controlled ProductFormula:C4N3·KColor and Shape:NeatMolecular weight:129.161




