CAS 34175-96-7

Pterosin B

Description:

Pterosin B is a naturally occurring chemical compound classified as a flavonoid, specifically a type of pterocarpan. It is primarily derived from various plant sources, particularly those in the legume family. Pterosin B is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. The compound exhibits a complex structure characterized by multiple rings and functional groups, which contribute to its reactivity and interaction with biological systems. Pterosin B is soluble in organic solvents, and its stability can be influenced by environmental factors such as light and temperature. Due to its natural origin, it is often studied for its role in traditional medicine and its potential applications in modern therapeutics. As with many flavonoids, Pterosin B may also play a role in plant defense mechanisms against pathogens and herbivores. Further research is ongoing to fully elucidate its mechanisms of action and potential health benefits.

Formula: C₁₄H₁₈O₂

InChI: InChI=1S/C14H18O2/c1-8-6-11-7-9(2)14(16)13(11)10(3)12(8)4-5-15/h6,9,15H,4-5,7H2,1-3H3/t9-/m1/s1

InChI key: InChIKey=SJNCSXMTBXDZQA-SECBINFHSA-N

SMILES: CC1=C2C(=CC(C)=C1CCO)C[C@@H](C)C2=O

Synonyms:

• (2R)-2,3-Dihydro-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one
• (2R)-6-(2-Hydroxyethyl)-2,5,7-trimethyl-1-indanone
• (2R)-Pterosin B
• 1-Indanone, 6-(2-hydroxyethyl)-2,5,7-trimethyl-, (-)-
• 1H-Inden-1-one, 2,3-dihydro-6-(2-hydroxyethyl)-2,5,7-trimethyl-, (R)-
• 1H-inden-1-one, 2,3-dihydro-6-(2-hydroxyethyl)-2,5,7-trimethyl-, (2R)-
• Pterosin B
• BI 2

(2R)-Pterosin B

CAS: 34175-96-7

Formula: C₁₄H₁₈O₂

Purity: 97%

Molecular weight: 218.2915

Ref: IN-DA00CL6W

Pterosin B

CAS: 34175-96-7

Formula: C₁₄H₁₈O₂

Purity: 95%~99%

Molecular weight: 218.296

Ref: BP-BP5047

Pterosin b

CAS: 34175-96-7

Ketone alcohol

Formula: C₁₄H₁₈O₂

Purity: ≥ 98.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 218.3

Ref: 5G-82794

Pterosin B

CAS: 34175-96-7

Pterosin B is a type of natural compound known as a terpenoid, which is derived from various fern species, particularly those of the Pteridium genus. This compound has attracted scientific interest due to its potential biochemical activities. Its mode of action involves the modulation of specific cellular signaling pathways that may influence inflammatory processes and oxidative stress responses. Such pathways include the NF-κB signaling cascade, which is pivotal in regulating immune and inflammatory responses within the body.

Formula: C₁₄H₁₈O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 218.29 g/mol

Ref: 3D-JBA17596

Pterosin B

CAS: 34175-96-7

Pterosin B, which is widely found in the leaves and shoots of green plants, is an inhibitor of salt-inducible kinase 3 (Sik3) signaling.

Formula: C₁₄H₁₈O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.29

Ref: TM-T12576