CAS 3418-24-4

2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane

Description:

2-(Bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane is a chemical compound characterized by its unique structure, which includes a dioxolane ring and a bromomethyl group. The presence of the 4-chlorophenyl substituent contributes to its aromatic properties, potentially influencing its reactivity and interactions with other molecules. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for compounds containing aromatic rings. The bromomethyl group can serve as a reactive site for further chemical transformations, making it useful in synthetic organic chemistry. Additionally, the chlorophenyl moiety may impart specific biological activities, making this compound of interest in medicinal chemistry. Safety considerations should be taken into account, as brominated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal protocols are essential when working with this substance in a laboratory setting.

Formula: C₁₀H₁₀BrClO₂

InChI: InChI=1/C10H10BrClO2/c11-7-10(13-5-6-14-10)8-1-3-9(12)4-2-8/h1-4H,5-7H2

SMILES: c1cc(ccc1C1(CBr)OCCO1)Cl

2-(Bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane

CAS: 3418-24-4

2-(Bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane

Purity: ≥95%

Molecular weight: 277.54g/mol

Ref: 54-OR28990