CymitQuimica logo

CAS 341965-74-0

:

4-Chloro-2-[[(2,6-dichlorophenyl)methyl]thio]-6-phenyl-5-pyrimidinecarbonitrile

Description:
4-Chloro-2-[[(2,6-dichlorophenyl)methyl]thio]-6-phenyl-5-pyrimidinecarbonitrile is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring, a nitrile group, and multiple chlorine substituents. This compound typically exhibits a high degree of lipophilicity due to the presence of aromatic rings and halogen atoms, which can influence its solubility and bioavailability. The thioether linkage contributes to its chemical reactivity and potential interactions in biological systems. As a pyrimidine derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chlorinated phenyl groups may enhance its activity against specific biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-Chloro-2-[[(2,6-dichlorophenyl)methyl]thio]-6-phenyl-5-pyrimidinecarbonitrile represents a class of compounds that may have significant applications in drug discovery and development.
Formula:C18H10Cl3N3S
InChI:InChI=1S/C18H10Cl3N3S/c19-14-7-4-8-15(20)13(14)10-25-18-23-16(11-5-2-1-3-6-11)12(9-22)17(21)24-18/h1-8H,10H2
InChI key:InChIKey=ANZPFMKHOIGHPF-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=NC(SCC2=C(Cl)C=CC=C2Cl)=NC1Cl)C3=CC=CC=C3
Synonyms:
  • 4-Chloro-2-[[(2,6-dichlorophenyl)methyl]thio]-6-phenyl-5-pyrimidinecarbonitrile
  • 5-Pyrimidinecarbonitrile, 4-chloro-2-[[(2,6-dichlorophenyl)methyl]thio]-6-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.