CymitQuimica logo

CAS 341965-86-4

:

Ethyl 4-(3,3-dimethyl-2-oxo-1-azetidinyl)benzoate

Description:
Ethyl 4-(3,3-dimethyl-2-oxo-1-azetidinyl)benzoate, identified by its CAS number 341965-86-4, is a chemical compound that features a unique structure combining an ethyl ester with a substituted azetidine ring. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic aromatic and aliphatic components. The presence of the azetidine ring suggests potential biological activity, as many compounds containing this moiety are studied for their pharmacological properties. Additionally, the compound may undergo typical reactions associated with esters, such as hydrolysis and transesterification. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, Ethyl 4-(3,3-dimethyl-2-oxo-1-azetidinyl)benzoate represents a compound of interest in both synthetic chemistry and potential medicinal applications.
Formula:C14H17NO3
InChI:InChI=1S/C14H17NO3/c1-4-18-12(16)10-5-7-11(8-6-10)15-9-14(2,3)13(15)17/h5-8H,4,9H2,1-3H3
InChI key:InChIKey=LCDLVNFLVOQOST-UHFFFAOYSA-N
SMILES:O=C1N(CC1(C)C)C2=CC=C(C(OCC)=O)C=C2
Synonyms:
  • Benzoic acid, 4-(3,3-dimethyl-2-oxo-1-azetidinyl)-, ethyl ester
  • Ethyl 4-(3,3-dimethyl-2-oxo-1-azetidinyl)benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.