CAS 341968-24-9
:2-[[(2,3-Dichlorophenyl)amino]methylene]-1,3-cyclohexanedione
Description:
2-[[(2,3-Dichlorophenyl)amino]methylene]-1,3-cyclohexanedione, identified by its CAS number 341968-24-9, is a chemical compound characterized by its unique structure that includes a cyclohexanedione core and a dichlorophenyl group. This compound typically exhibits properties associated with both amines and diketones, which may influence its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dichlorophenyl moiety suggests that it may possess significant biological activity, potentially acting as an inhibitor or modulator in biochemical pathways. Additionally, the compound's structure may confer lipophilicity, affecting its solubility and permeability in biological systems. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions should be considered, as compounds with halogenated groups can exhibit toxicity or environmental persistence. Overall, this compound represents a class of molecules that may have valuable applications in medicinal chemistry and material science.
Formula:C13H11Cl2NO2
InChI:InChI=1S/C13H11Cl2NO2/c14-9-3-1-4-10(13(9)15)16-7-8-11(17)5-2-6-12(8)18/h1,3-4,7,16H,2,5-6H2
InChI key:InChIKey=XRJKKAXCBDEGDE-UHFFFAOYSA-N
SMILES:C(NC1=C(Cl)C(Cl)=CC=C1)=C2C(=O)CCCC2=O
Synonyms:- 2-[[(2,3-Dichlorophenyl)amino]methylene]-1,3-cyclohexanedione
- 1,3-Cyclohexanedione, 2-[[(2,3-dichlorophenyl)amino]methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-{[(2,3-Dichlorophenyl)amino]methylidene}cyclohexane-1,3-dione
CAS:2-{[(2,3-Dichlorophenyl)amino]methylidene}cyclohexane-1,3-dionePurity:techMolecular weight:284.14g/mol
