CymitQuimica logo

CAS 341968-25-0

:

2-[[(2,4-Dichlorophenyl)amino]methylene]-1,3-cyclohexanedione

Description:
2-[[(2,4-Dichlorophenyl)amino]methylene]-1,3-cyclohexanedione, identified by its CAS number 341968-25-0, is a chemical compound characterized by its unique structure, which includes a cyclohexanedione core substituted with a 2,4-dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. It may display moderate to high solubility in organic solvents, while its solubility in water can vary based on pH and temperature. The presence of the dichlorophenyl moiety suggests potential applications in pharmaceuticals or agrochemicals, as such structures are often linked to biological activity. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the presence of the imine functional group. Safety and handling precautions should be observed, as with many organic compounds, particularly those containing halogens, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H11Cl2NO2
InChI:InChI=1S/C13H11Cl2NO2/c14-8-4-5-11(10(15)6-8)16-7-9-12(17)2-1-3-13(9)18/h4-7,16H,1-3H2
InChI key:InChIKey=LJZNWSGJVVIXFA-UHFFFAOYSA-N
SMILES:C(NC1=C(Cl)C=C(Cl)C=C1)=C2C(=O)CCCC2=O
Synonyms:
  • 2-[[(2,4-Dichlorophenyl)amino]methylene]-1,3-cyclohexanedione
  • 1,3-Cyclohexanedione, 2-[[(2,4-dichlorophenyl)amino]methylene]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.