CymitQuimica logo

CAS 341968-26-1

:

2-[[(4-Bromophenyl)amino]methylene]-1,3-cyclohexanedione

Description:
2-[[(4-Bromophenyl)amino]methylene]-1,3-cyclohexanedione, identified by its CAS number 341968-26-1, is a chemical compound characterized by its unique structure, which includes a cyclohexanedione core substituted with a 4-bromophenyl group and an imine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the bromine atom enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyclohexanedione moiety can participate in tautomeric equilibria, influencing its stability and reactivity. The compound may also exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.
Formula:C13H12BrNO2
InChI:InChI=1S/C13H12BrNO2/c14-9-4-6-10(7-5-9)15-8-11-12(16)2-1-3-13(11)17/h4-8,15H,1-3H2
InChI key:InChIKey=OUTMYOKGEMSCOO-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Br)C=C1)=C2C(=O)CCCC2=O
Synonyms:
  • 2-[[(4-Bromophenyl)amino]methylene]-1,3-cyclohexanedione
  • 1,3-Cyclohexanedione, 2-[[(4-bromophenyl)amino]methylene]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.