CAS 341971-45-7

Actinidic acid

Description:

Actinidic acid, with the CAS number 341971-45-7, is a chemical compound that belongs to the class of organophosphorus acids. It is characterized by its unique structure, which includes a phosphorus atom bonded to oxygen and carbon-containing groups. This compound is typically studied for its potential applications in various fields, including materials science and catalysis. Actinidic acid may exhibit properties such as acidity, reactivity with nucleophiles, and the ability to form complexes with metal ions, which can be significant in chemical synthesis and industrial processes. Its behavior in solution can be influenced by factors such as pH and the presence of other ions. While specific physical properties like melting point, boiling point, and solubility may vary, actinidic acid is generally recognized for its role in advancing research in organophosphorus chemistry. As with any chemical substance, proper handling and safety precautions are essential due to potential hazards associated with its use.

Formula: C₃₀H₄₆O₅

InChI: InChI=1S/C30H46O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,18,20-24,31-33H,1,8-16H2,2-6H3,(H,34,35)/t18-,20+,21+,22+,23-,24-,26-,27-,28+,29+,30-/m0/s1

InChI key: InChIKey=FFMVHFPLIIYYNC-QXIFDOFRSA-N

SMILES: C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CCC(=C)[C@@H]4C)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@@](CO)(C)[C@@H](O)[C@H](O)C5)[H])[H]

Synonyms:

• (2α,3β,4α)-2,3,23-Trihydroxyursa-12,20(30)-dien-28-oic acid
• Ursa-12,20(30)-dien-28-oic acid, 2,3,23-trihydroxy-, (2α,3β,4α)-
• Actinidic acid

Actinidic acid

CAS: 341971-45-7

Actinidic acid is a triterpene phytoalexin from unripe kiwi fruit.

Formula: C₃₀H₄₆O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 486.68

Ref: TM-TN3346

Actinidic acid

CAS: 341971-45-7

Formula: C₃₀H₄₆O₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 486.693

Ref: BP-SBP01566

10,11-Dihydroxy-9-(hydroxymethyl)-1,6a,6b,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4 a-carboxylic acid

Controlled Product

CAS: 341971-45-7

(1S,2R,3R,4S)-10,11-dihydroxy-9-[(hydroxymethyl)methyl]-1,6a,6b,9,12a-pentamethyl-2-methylidene-1,3,4,5,6a,7,8a-hexadecahydropicene-4a-carboxylic acid is a natural compound that has been shown to have antifungal effects. It inhibits the production of beta-glucosidase and alpha amylase in pancreatic cells. This compound also inhibits the growth of Candida albicans and Aspergillus flavus. (1S,2R,3R) -10-(hydroxymethyl)-9-[(hydroxymethyl)methyl]-1 6a ,6b ,9 12 a -pentamethyl 2 methylidene 1 3 4 5 6 a 7 8

Formula: C₃₀H₄₆O₅

Purity: Min. 95%

Molecular weight: 486.7 g/mol

Ref: 3D-RNA97145