CAS 34199-07-0
:Propanamide, 3,3′-dithiobis[2-amino-N-(4-nitrophenyl)-, (2R,2′R)-
Description:
Propanamide, 3,3′-dithiobis[2-amino-N-(4-nitrophenyl)-, (2R,2′R)-, commonly referred to by its CAS number 34199-07-0, is a chemical compound characterized by its amide functional group and the presence of a dithiobis linkage. This compound features two amino groups attached to a nitrophenyl moiety, which contributes to its potential as a biological or pharmaceutical agent. The presence of the nitro group typically enhances the compound's reactivity and may influence its electronic properties, making it useful in various chemical applications. The stereochemistry indicated by (2R,2′R)- suggests specific spatial arrangements of its atoms, which can affect its interactions and biological activity. Additionally, the dithiobis structure implies the presence of sulfur atoms, which can impart unique properties such as increased stability or reactivity in certain environments. Overall, this compound may be of interest in fields such as medicinal chemistry, materials science, or biochemistry due to its complex structure and potential functional applications.
Formula:C18H20N6O6S2
InChI:InChI=1S/C18H20N6O6S2/c19-15(17(25)21-11-1-5-13(6-2-11)23(27)28)9-31-32-10-16(20)18(26)22-12-3-7-14(8-4-12)24(29)30/h1-8,15-16H,9-10,19-20H2,(H,21,25)(H,22,26)/t15-,16-/m0/s1
InChI key:InChIKey=UDNQCHDHUMEZRM-HOTGVXAUSA-N
SMILES:N(C([C@H](CSSC[C@@H](C(NC1=CC=C(N(=O)=O)C=C1)=O)N)N)=O)C2=CC=C(N(=O)=O)C=C2
Synonyms:- <span class="text-smallcaps">L</span>-Cystinebis(p-nitroanilide)
- Cystine-bis-4-nitroanilide
- N,N'-bis(4-nitrophenyl)cystinamide
- Propanamide, 3,3'-dithiobis(2-amino-N-(4-nitrophenyl)-, (R-(R*,R*))-
- Propanamide, 3,3′-dithiobis[2-amino-N-(4-nitrophenyl)-, (2R,2′R)-
- Propionanilide, 3,3′′-dithiobis[2-amino-4′-nitro-, <span class="text-smallcaps">L</span>-
- L-Cystinebis(p-nitroanilide)
- Propionanilide, 3,3′′-dithiobis[2-amino-4′-nitro-, L-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(H-Cys-pNA)2 (Disulfide bond)
CAS:<p>H-Cys-pNA is a labile molecule that has been used as a substrate for aminopeptidase activity. It is a competitive inhibitor of aminopeptidase and binds to the active site of the enzyme, preventing it from cleaving peptides from their amino acids. H-Cys-pNA has been shown to inhibit oxytocin release by binding to the oxytocin receptor in rat brain tissue. This molecule also inhibits the growth of dysgerminoma cells in vitro and blocks cell division. H-Cys-pNA is susceptible to proteolytic degradation and may be degraded by polyacrylamide gel electrophoresis, which can be used for its analysis on polyacrylamide gels.</p>Formula:C18H20N6O6S2Purity:Min. 95%Molecular weight:480.52 g/mol

