CAS 3420-72-2: 2′-Hydroxy-4,4′,6′-trimethoxychalcone
Description:2′-Hydroxy-4,4′,6′-trimethoxychalcone, with the CAS number 3420-72-2, is a synthetic organic compound belonging to the chalcone class, characterized by its distinctive structure that includes a chalcone backbone with three methoxy groups and a hydroxyl group. This compound typically exhibits a yellow to orange color, which is common among chalcones due to their conjugated double bond systems. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmaceutical research. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. Additionally, the hydroxyl group can participate in hydrogen bonding, potentially affecting its pharmacokinetic properties. Overall, 2′-Hydroxy-4,4′,6′-trimethoxychalcone represents a valuable compound for further exploration in medicinal chemistry and natural product synthesis.
Formula:C18H18O5
InChI:InChI=1S/C18H18O5/c1-21-13-7-4-12(5-8-13)6-9-15(19)18-16(20)10-14(22-2)11-17(18)23-3/h4-11,20H,1-3H3
InChI key:InChIKey=CGIBCVBDFUTMPT-UHFFFAOYSA-N
SMILES:O=C(C=CC1=CC=C(OC)C=C1)C=2C(O)=CC(OC)=CC2OC
- Synonyms:
- (2E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one
- 1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one
- 2-Propen-1-one, 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)-
- 2′-Hydroxy-4,4′,6′-trimethoxychalcone
- 4-Methoxybenzylidene(4,6-dimethoxy-2-hydroxyacetophenone)
- Chalcone, 2′-hydroxy-4,4′,6′-trimethoxy-
- NSC 37445
