CAS 34201-01-9

3,4-Dihydro-2H-pyran-2-carboxylic acid

Description:

3,4-Dihydro-2H-pyran-2-carboxylic acid is a cyclic compound characterized by its pyran ring structure, which features a carboxylic acid functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of both the carboxylic acid and the cyclic ether functionalities, making it a useful intermediate in organic synthesis. The compound is soluble in polar solvents, such as water and alcohols, due to the polar nature of the carboxylic acid group. Its chemical properties allow it to participate in various reactions, including esterification and nucleophilic substitutions. Additionally, 3,4-Dihydro-2H-pyran-2-carboxylic acid may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₆H₈O₃

InChI: InChI=1S/C6H8O3/c7-6(8)5-3-1-2-4-9-5/h2,4-5H,1,3H2,(H,7,8)

InChI key: InChIKey=OTLWUWJIIXAOEO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCC=CO1

Synonyms:

• 2H-Pyran-2-carboxylic acid, 3,4-dihydro-
• 3,4-Dihydro-2H-pyran-2-carboxylic acid

3,4-Dihydro-2H-pyran-2-carboxylic acid

CAS: 34201-01-9

3,4-Dihydro-2H-pyran-2-carboxylic acid

Purity: ≥95%

Molecular weight: 128.13g/mol

Ref: 54-OR6614