CAS 342013-78-9

5-bromo-N-tert-butylpyridine-3-carboxamide

Description:

5-Bromo-N-tert-butylpyridine-3-carboxamide is a chemical compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 3-position with a carboxamide functional group. The tert-butyl group attached to the nitrogen atom enhances the compound's lipophilicity, potentially influencing its solubility and biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The presence of the bromine atom can also impart unique reactivity, allowing for further derivatization. As with many organic compounds, safety data should be consulted, as it may pose hazards if not handled properly. Overall, 5-bromo-N-tert-butylpyridine-3-carboxamide is a versatile compound with potential applications in various chemical research fields.

Formula: C₁₀H₁₃BrN₂O

InChI: InChI=1/C10H13BrN2O/c1-10(2,3)13-9(14)7-4-8(11)6-12-5-7/h4-6H,1-3H3,(H,13,14)

SMILES: CC(C)(C)N=C(c1cc(cnc1)Br)O

5-Bromo-N-tert-butylnicotinamide

CAS: 342013-78-9

Formula: C₁₀H₁₃BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 257.1270

Ref: IN-DA00C0Y0

5-Bromo-N-tert-butylnicotinamide 98%

CAS: 342013-78-9

5-Bromo-N-tert-butylnicotinamide 98%

Purity: 98%

Ref: 54-OR3546

5-Bromo-N-tert-butylnicotinamide

CAS: 342013-78-9

Formula: C₁₀H₁₃BrN₂O

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 257.131

Ref: 10-F300937