CAS 342042-82-4

5-(benzyloxy)-2-fluoroaniline

Description:

5-(Benzyloxy)-2-fluoroaniline is an organic compound characterized by the presence of a fluoro group, an aniline moiety, and a benzyloxy substituent. Its molecular structure features a fluorine atom attached to the second position of a benzene ring, while a benzyloxy group is located at the fifth position. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the amino and fluoro functional groups. The aniline part of the molecule can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions, making it a valuable intermediate in organic synthesis. Additionally, the benzyloxy group can enhance the lipophilicity of the compound, potentially influencing its biological activity and interactions. Overall, 5-(benzyloxy)-2-fluoroaniline is of interest in medicinal chemistry and materials science due to its unique structural features and reactivity.

Formula: C₁₃H₁₂FNO

InChI: InChI=1/C13H12FNO/c14-12-7-6-11(8-13(12)15)16-9-10-4-2-1-3-5-10/h1-8H,9,15H2

SMILES: c1ccc(cc1)COc1ccc(c(c1)N)F

Synonyms:

• Benzenamine, 2-Fluoro-5-(Phenylmethoxy)-

5-Benzyloxy-2-fluoroaniline

CAS: 342042-82-4

Formula: C₁₃H₁₂FNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.2389

Ref: IN-DA00C77P

5-(Benzyloxy)-2-fluoroaniline

CAS: 342042-82-4

5-(Benzyloxy)-2-fluoroaniline

Purity: 97%

Molecular weight: 217.24g/mol

Ref: 54-PC201234

5-(Benzyloxy)-2-fluoroaniline

CAS: 342042-82-4

Formula: C₁₃H₁₂FNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.243

Ref: 10-F329778