CAS 34212-59-4

2-methyl-5-(propan-2-yl)cyclohexyl 5-methyl-2-(propan-2-yl)cyclohexyl butanedioate

Description:

2-Methyl-5-(propan-2-yl)cyclohexyl 5-methyl-2-(propan-2-yl)cyclohexyl butanedioate, with CAS number 34212-59-4, is an organic compound characterized by its complex structure, which includes cyclohexyl rings and butanedioate moieties. This substance is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is known for its potential applications in the fragrance and flavor industry due to its pleasant odor profile. The presence of multiple alkyl groups contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. Additionally, the compound may exhibit moderate volatility and stability under standard conditions, although it should be handled with care due to potential reactivity with strong oxidizing agents. Its synthesis often involves multi-step organic reactions, highlighting its complexity and the need for careful control of reaction conditions to achieve desired yields and purity.

Formula: C₂₄H₄₂O₄

InChI: InChI=1/C24H42O4/c1-15(2)19-9-8-18(6)21(14-19)27-23(25)11-12-24(26)28-22-13-17(5)7-10-20(22)16(3)4/h15-22H,7-14H2,1-6H3

SMILES: CC(C)C1CCC(C)C(C1)OC(=O)CCC(=O)OC1CC(C)CCC1C(C)C

(1R)-(-)-Dimenthyl succinate

CAS: 34212-59-4

Formula: C₂₄H₄₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 394.5879

Ref: IN-DA00C6EZ

(1R)-(−)-Dimenthyl Succinate

CAS: 34212-59-4

(1R)-(−)-Dimenthyl Succinate

Purity: 99%

Molecular weight: 394.59g/mol

Ref: 54-OR1028742

bis((1R,2S,5R)-2-isopropyl-5-methylcyclohexyl) succinate

CAS: 34212-59-4

Purity: 95%

Molecular weight: 394.5960083

Ref: 10-F788499

Dimenthyl Succinate

Controlled Product

CAS: 34212-59-4

Applications Dimethyl Succinate is used in the synthesis of antifungal agents and synthetic analogues.
References Lee, E. et al.: Ange. Chem. Int. Ed., 41, 176 (2002); Trost, B.M. et al.: J. Am. Chem. Soc., 124, 10396 (2002);

Formula: C₂₄H₄₂O₄

Color and Shape: Neat

Molecular weight: 394.59

Ref: TR-D479270