CAS 34213-34-8
:methyl (3S,4S,5S,6R)-3,4,5-triacetoxy-6-methoxy-tetrahydropyran-2-carboxylate
Description:
Methyl (3S,4S,5S,6R)-3,4,5-triacetoxy-6-methoxy-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy and methoxy groups, contributing to its reactivity and solubility properties. The presence of these acetoxy groups indicates that it can undergo hydrolysis, leading to the release of acetic acid and the formation of corresponding alcohols. The stereochemistry denoted by the (3S,4S,5S,6R) configuration suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions with other molecules. This compound is likely to be soluble in organic solvents due to its hydrophobic characteristics, while the carboxylate group may impart some degree of polarity. Its potential applications could span various fields, including pharmaceuticals and organic synthesis, where such derivatives are often utilized for their biological properties or as intermediates in chemical reactions.
Formula:C14H20O10
InChI:InChI=1/C14H20O10/c1-6(15)21-9-10(22-7(2)16)12(23-8(3)17)14(20-5)24-11(9)13(18)19-4/h9-12,14H,1-5H3/t9-,10-,11?,12-,14+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester
CAS:Formula:C14H20O10Purity:95%Color and Shape:SolidMolecular weight:348.3026β-D-Glucopyranosiduronic acid,methyl,methyl ester,2,3,4-triacetate
CAS:β-D-Glucopyranosiduronic acid,methyl,methyl ester,2,3,4-triacetatePurity:95%Methyl 2,3,4-Tri-O-acetyl-β-D-glucuronic Acid Methyl Ester
CAS:Controlled Product<p>Applications Methyl 2,3,4-Tri-O-acetyl-β-D-glucuronic Acid Methyl Ester (cas# 34213-34-8) is a compound useful in organic synthesis.<br></p>Formula:C14H20O10Color and Shape:NeatMolecular weight:348.30Methyl 2,3,4-Tri-O-acetyl-b-D-glucuronic Acid Methyl Ester
CAS:Formula:C14H20O10Purity:95%Molecular weight:348.304Methyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester
CAS:<p>Methyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester is a custom synthesis chemical. It has a molecular weight of 342.13 g/mol and the abbreviation CAS No. 34213-34-8. Methyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester is used as a Modification chemical in Fluorination reactions and can be used to synthesize Oligosaccharides and Polysaccharides. This chemical reacts with Glycosylation reactions to form complex carbohydrates such as saccharides and sugar.</p>Formula:C14H20O10Purity:Min. 95%Molecular weight:348.31 g/mol





