CAS 3422-39-7
:L-Glutamyl-L-tyrosine
Description:
L-Glutamyl-L-tyrosine, with the CAS number 3422-39-7, is a dipeptide composed of the amino acids L-glutamic acid and L-tyrosine linked by a peptide bond. This compound is characterized by its role in protein synthesis and its involvement in various biochemical processes. It exhibits properties typical of peptides, such as solubility in water and the ability to form hydrogen bonds due to the presence of functional groups like carboxyl and amino groups. L-Glutamyl-L-tyrosine may also play a role in neurotransmission and metabolic pathways, given the individual functions of its constituent amino acids. In terms of stability, it is generally stable under physiological conditions but may be susceptible to hydrolysis in extreme pH or temperature conditions. Additionally, it can be utilized in research and pharmaceutical applications, particularly in studies related to neurobiology and metabolic regulation. As with many peptides, its biological activity can be influenced by its concentration and the presence of other biomolecules.
Formula:C14H18N2O6
InChI:InChI=1S/C14H18N2O6/c15-10(5-6-12(18)19)13(20)16-11(14(21)22)7-8-1-3-9(17)4-2-8/h1-4,10-11,17H,5-7,15H2,(H,16,20)(H,18,19)(H,21,22)/t10-,11-/m0/s1
InChI key:InChIKey=YSWHPLCDIMUKFE-QWRGUYRKSA-N
SMILES:C([C@H](NC([C@H](CCC(O)=O)N)=O)C(O)=O)C1=CC=C(O)C=C1
Synonyms:- 22: PN: EP2161028 PAGE: 10 claimed protein
- <span class="text-smallcaps">L</smallcap>-Glutamyl-<smallcap>L</span>-tyrosine
- <span class="text-smallcaps">L</smallcap>-Tyrosine, <smallcap>L</span>-α-glutamyl-
- <span class="text-smallcaps">L</smallcap>-Tyrosine, N-<smallcap>L</span>-α-glutamyl-
- <span class="text-smallcaps">L</smallcap>-α-Glutamyl-<smallcap>L</span>-tyrosine
- Alpha-Glutamyltyrosine
- L-alpha-glutamyl-D-tyrosine
- NSC 523821
- Tyrosine, N-<span class="text-smallcaps">L</smallcap>-α-glutamyl-, <smallcap>L</span>-
- L-Tyrosine, N-L-α-glutamyl-
- L-Glutamyl-L-tyrosine
- L-Tyrosine, L-α-glutamyl-
- Tyrosine, N-L-α-glutamyl-, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Glu-Tyr-OH
CAS:<p>Bachem ID: 4003475.</p>Formula:C14H18N2O6Purity:> 99%Color and Shape:White PowderMolecular weight:310.31H-Glu-Tyr-OH
CAS:<p>H-Glu-Tyr-OH is an amino acid derivative that has been shown to have anti-cancer properties. It inhibits the growth of cancer cells by binding to the surface of the tumor and inhibiting the production of angiogenic factors. This leads to a decrease in tumor size and an increase in light emission, which can be detected with light exposure. H-Glu-Tyr-OH also inhibits protein synthesis and cell proliferation, leading to death of tumor cells. The mechanism of action for H-Glu-Tyr-OH is through its ability to inhibit DNA topoisomerase I and II, which are enzymes that maintain the integrity of DNA. These enzymes are essential for DNA replication and transcription, so their inhibition results in cell death.</p>Formula:C14H18N2O6Purity:Min. 95%Molecular weight:310.3 g/mol


