CAS 34231-22-6

(3-(aminomethyl)phenyl)methanol

Description:

(3-(Aminomethyl)phenyl)methanol, with the CAS number 34231-22-6, is an organic compound characterized by the presence of both an amino group and a hydroxymethyl group attached to a phenyl ring. This compound features a phenyl group substituted at the meta position with an aminomethyl group (-CH2NH2) and a hydroxymethyl group (-CH2OH), which contributes to its potential as a versatile building block in organic synthesis. The amino group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents, while the hydroxymethyl group can act as a functional site for further chemical modifications. The presence of these functional groups suggests that (3-(aminomethyl)phenyl)methanol may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structure allows for potential applications in materials science and as an intermediate in the synthesis of more complex organic molecules. Overall, this compound's unique combination of functional groups provides a foundation for various chemical reactivity and applications.

Formula: C₈H₁₁NO

InChI: InChI=1/C8H11NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,10H,5-6,9H2

SMILES: c1cc(cc(c1)CO)CN

[3-(Aminomethyl)phenyl]methanol

CAS: 34231-22-6

Formula: C₈H₁₁NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 137.1790

Ref: IN-DA0035WG

(3-(Aminomethyl)phenyl)methanol

CAS: 34231-22-6

(3-(Aminomethyl)phenyl)methanol

Purity: 97%

Molecular weight: 137.18g/mol

Ref: 54-OR93914

(3-(Aminomethyl)phenyl)methanol

CAS: 34231-22-6

Formula: C₈H₁₁NO

Purity: 97%

Color and Shape: Light yellow crystalline powder

Molecular weight: 137.182

Ref: 10-F092446