CymitQuimica logo

CAS 34231-77-1

:

Pyridazine-4-carboxylic acid methyl ester

Description:
Pyridazine-4-carboxylic acid methyl ester is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with a methyl group, making it a methyl ester derivative. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the carboxylate group contributes to its polar nature, influencing its solubility in polar solvents such as water and alcohols. Pyridazine derivatives are known for their biological activity, and this compound may exhibit properties that could be of interest in pharmaceuticals or agrochemicals. Its reactivity is influenced by the electron-withdrawing nature of the nitrogen atoms in the pyridazine ring, which can affect its behavior in chemical reactions, such as nucleophilic substitutions or coupling reactions. Overall, pyridazine-4-carboxylic acid methyl ester is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c1-10-6(9)5-2-3-7-8-4-5/h2-4H,1H3
InChI key:IJFLWNYKGMQQOW-UHFFFAOYSA-N
SMILES:COC(=O)c1ccnnc1
Synonyms:
  • 4-Pyridazinecarboxylic acid, methyl ester
  • Methyl pyridazine-4-carboxylate
Found 4 products.