CAS 34231-96-4

3-chloro-2,1-benzothiazole

Description:

3-Chloro-2,1-benzothiazole is a heterocyclic organic compound characterized by the presence of both a benzene ring and a thiazole ring, with a chlorine substituent at the 3-position of the thiazole. This compound typically appears as a solid and is known for its pale yellow to light brown color. It is soluble in organic solvents but has limited solubility in water. The presence of the chlorine atom contributes to its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 3-chloro-2,1-benzothiazole exhibits antimicrobial and antifungal properties, which can be leveraged in the development of biocides and preservatives. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Overall, its unique structure and properties make it a valuable compound in both industrial and research settings.

Formula: C₇H₄ClNS

InChI: InChI=1/C7H4ClNS/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H

SMILES: c1ccc2c(c1)c(Cl)sn2

Synonyms:

• 2,1-Benzisothiazole, 3-Chloro-

3-Chlorobenzo[c]isothiazole

CAS: 34231-96-4

Formula: C₇H₄ClNS

Molecular weight: 169.6314

Ref: IN-DA00CM35

3-Chloro-2,1-benzothiazole

CAS: 34231-96-4

3-Chloro-2,1-benzothiazole is an anti-inflammatory drug that has been shown to inhibit the cyclization of arachidonic acid to prostaglandin G2. This drug is a thiobenzamide and is structurally related to other drugs with anti-inflammatory properties. 3-Chloro-2,1-benzothiazole has been shown to reduce inflammation by inhibiting the production of prostaglandins and leukotrienes. It also inhibits amine oxidase, which breaks down amines such as histamine and serotonin.

Formula: C₇H₄ClNS

Purity: Min. 95%

Molecular weight: 169.63 g/mol

Ref: 3D-JBA23196