CAS 34232-17-2
:5-hydroxy-3-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-(carboxyacetyl)-beta-D-glucopyranoside
Description:
5-Hydroxy-3-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-(carboxyacetyl)-beta-D-glucopyranoside, with the CAS number 34232-17-2, is a complex organic compound characterized by its chromenone structure, which features a chromone backbone substituted with various functional groups. This compound includes a hydroxyl group, a methoxyphenyl moiety, and a glucopyranoside unit with a carboxyacetyl substituent. The presence of these functional groups suggests potential biological activity, possibly including antioxidant or anti-inflammatory properties, as many flavonoid derivatives exhibit such effects. The glucopyranoside portion may enhance solubility and bioavailability, making it of interest in pharmacological studies. Additionally, the compound's structural complexity indicates that it may participate in various chemical reactions, including glycosylation and esterification. Its unique combination of features positions it as a candidate for further research in medicinal chemistry and natural product synthesis, particularly in the context of developing new therapeutic agents.
Formula:C25H24O13
InChI:InChI=1S/C25H24O13/c1-34-12-4-2-11(3-5-12)14-9-35-16-7-13(6-15(26)20(16)21(14)30)37-25-24(33)23(32)22(31)17(38-25)10-36-19(29)8-18(27)28/h2-7,9,17,22-26,31-33H,8,10H2,1H3,(H,27,28)/t17-,22-,23+,24-,25-/m1/s1
InChI key:InChIKey=VRCBYTZZZFFKEN-RBZNUJCTSA-N
SMILES:O=C1C=2C(=CC(O[C@@H]3O[C@H](COC(CC(O)=O)=O)[C@@H](O)[C@H](O)[C@H]3O)=CC2O)OC=C1C4=CC=C(OC)C=C4
Synonyms:- 4H-1-Benzopyran-4-one, 7-[[6-O-(carboxyacetyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-3-(4-methoxyphenyl)-
- Biochanin A 7-O-glucoside 6′′-O-malonate
- Biochanin A 7-O-β-D-glucoside 6′′-O-malonate
- 7-[[6-O-(Carboxyacetyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Isoflavone, 5,7-dihydroxy-4′-methoxy-, 7-β-D-glucopyranoside 6′-(hydrogen malonate)
- Biochanin A 7-O-(6-O-malonyl-beta-D-glucoside)
- Sissotrin 6''-O-malonate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Biochanin A 7-O-β-D-glucoside 6''-O-malonate
CAS:Controlled ProductFormula:C25H24O13Color and Shape:NeatMolecular weight:532.45Biochanin A 7-O-glucoside 6''-O-malonate
CAS:<p>Biochanin A 7-O-glucoside 6''-O-malonate is a naturally occurring isoflavone glycoside, which is a secondary metabolite commonly found in various plant species. This compound is primarily sourced from legumes such as red clover. Isoflavones and their derivatives are well-regarded for their ability to modulate estrogenic activity due to their structural similarity to endogenous estrogens. Biochanin A 7-O-glucoside 6''-O-malonate acts through various biochemical pathways, including binding to estrogen receptors and influencing gene expression related to hormonal regulation.</p>Formula:C25H24O13Purity:Min. 95%Molecular weight:532.4 g/mol


