CAS 34232-43-4

3-(3-aminophenyl)oxazolidin-2-one

Description:

3-(3-Aminophenyl)oxazolidin-2-one, with the CAS number 34232-43-4, is a heterocyclic organic compound characterized by the presence of an oxazolidinone ring, which is a five-membered cyclic structure containing both nitrogen and oxygen atoms. This compound features an amino group attached to a phenyl ring, contributing to its potential biological activity. The oxazolidinone structure is known for its role in various pharmaceutical applications, particularly as a scaffold in the development of antibacterial agents. The presence of the amino group can enhance solubility and reactivity, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific stereochemical properties due to the chiral center in the oxazolidinone ring, which can influence its interaction with biological targets. Overall, 3-(3-aminophenyl)oxazolidin-2-one is of interest in medicinal chemistry for its potential therapeutic applications and as a building block for more complex molecules.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1/C9H10N2O2/c10-7-2-1-3-8(6-7)11-4-5-13-9(11)12/h1-3,6H,4-5,10H2

SMILES: c1cc(cc(c1)N1CCOC1=O)N

Synonyms:

• 2-Oxazolidinone, 3-(3-Aminophenyl)-

3-(3-aminophenyl)-1,3-oxazolidin-2-one

CAS: 34232-43-4

Formula: C₉H₁₀N₂O₂

Purity: %

Molecular weight: 178.1879

Ref: IN-DA00C8R8

3-(3-Aminophenyl)oxazolidin-2-one

CAS: 34232-43-4

3-(3-Aminophenyl)oxazolidin-2-one

Purity: 95%

Molecular weight: 178.19g/mol

Ref: 54-OR1064790

3-(3-Aminophenyl)-1,3-oxazolidin-2-one

CAS: 34232-43-4

3-(3-Aminophenyl)-1,3-oxazolidin-2-one is a fine chemical that is used as a building block for more complex compounds. It has been shown to be an effective reagent for the synthesis of complex compounds and can be used as a reaction component in research. 3-(3-Aminophenyl)-1,3-oxazolidin-2-one is also useful in the production of pharmaceuticals and other specialty chemicals.

Formula: C₉H₁₀N₂O₂

Purity: (¹H-Nmr) Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 178.19 g/mol

Ref: 3D-FA133262

3-(3-aminophenyl)-1,3-oxazolidin-2-one

CAS: 34232-43-4

Formula: C₉H₁₀N₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 178.191

Ref: 10-F311702