CAS 34234-44-1
:methyl 2,3,4-tris-O-(phenylcarbonyl)-alpha-D-glucopyranoside
Description:
Methyl 2,3,4-tris-O-(phenylcarbonyl)-alpha-D-glucopyranoside is a glycoside derivative of glucose, characterized by the presence of three phenylcarbonyl groups attached to the hydroxyl positions at the 2, 3, and 4 positions of the glucopyranose ring. This compound features a methyl group at the anomeric position, which influences its solubility and reactivity. The phenylcarbonyl groups enhance the compound's lipophilicity and can participate in various chemical reactions, making it useful in organic synthesis and as a potential intermediate in the preparation of more complex molecules. The presence of these functional groups also suggests that the compound may exhibit interesting biological activities, although specific biological properties would require further investigation. Additionally, the compound's structure allows for potential applications in the fields of medicinal chemistry and materials science, particularly in the development of glycosylated compounds with tailored properties. Overall, methyl 2,3,4-tris-O-(phenylcarbonyl)-alpha-D-glucopyranoside is a versatile compound with significant implications in chemical research and application.
Formula:C28H26O9
InChI:InChI=1/C28H26O9/c1-33-28-24(37-27(32)20-15-9-4-10-16-20)23(36-26(31)19-13-7-3-8-14-19)22(21(17-29)34-28)35-25(30)18-11-5-2-6-12-18/h2-16,21-24,28-29H,17H2,1H3/t21-,22-,23+,24-,28+/m1/s1
Synonyms:- Methyl 2,3,4-Tri-O-benzoyl-α-D-glucopyranoside
- α-D-glucopyranoside, methyl, 2,3,4-tribenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3,4-Tri-O-benzoyl-α-D-glucopyranoside
CAS:Formula:C28H26O9Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:506.51Methyl 2,3,4-tri-o-benzoyl-α-d-glucopyranoside
CAS:Formula:C28H26O9Purity:98%Color and Shape:SolidMolecular weight:506.5006Methyl 2,3,4-Tri-O-Benzoyl-α-D-Glucopyranoside
CAS:Methyl 2,3,4-Tri-O-Benzoyl-α-D-GlucopyranosidePurity:98%Molecular weight:506.50g/molMethyl 2,3,6-tri-O-benzoyl-a-D-glucopyranoside
CAS:<p>Methyl 2,3,6-tri-O-benzoyl-a-D-glucopyranoside is a biodegradable polymer that can be used for the prevention of boron diffusion into a prosthesis. It is also resistant to corrosion. Methyl 2,3,6-tri-O-benzoyl-a-D-glucopyranoside has been shown to have a transition temperature of 232 °C and this property makes it suitable for use in high temperature applications. This material is resistant to refractory environments and can be used as an additive in thermodynamic systems.</p>Formula:C28H26O9Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:506.5 g/mol




