CAS 342405-25-8: 2-{[4-(chloromethyl)-1,3-thiazol-2-yl]methyl}-1,3-benzothiazole

Description: 2-{[4-(Chloromethyl)-1,3-thiazol-2-yl]methyl}-1,3-benzothiazole is a chemical compound characterized by its complex structure, which includes both thiazole and benzothiazole moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high solubility in organic solvents and potential reactivity due to the presence of the chloromethyl group. The thiazole ring contributes to its biological activity, often making it a candidate for pharmaceutical applications, particularly in the development of antimicrobial or anticancer agents. The chloromethyl substituent can serve as a reactive site for further chemical modifications, enhancing its utility in synthetic chemistry. Additionally, the compound may exhibit fluorescence properties, which can be advantageous in various analytical applications. Overall, its unique structural features and functional groups suggest a diverse range of potential applications in medicinal chemistry and materials science.

Formula: C₁₂H₉ClN₂S₂

InChI: InChI=1/C12H9ClN2S2/c13-6-8-7-16-11(14-8)5-12-15-9-3-1-2-4-10(9)17-12/h1-4,7H,5-6H2

2-((4-(Chloromethyl)thiazol-2-yl)methyl)benzo[d]thiazole

CAS: 342405-25-8

• Purity: 98%
• Molecular weight: 280.7900085449219

2-{[4-(Chloromethyl)-1,3-thiazol-2-yl]methyl}-1,3-benzothiazole hydrochloride

CAS: 342405-25-8

• Purity: 90.0%
• Molecular weight: 317.25

2-([4-(Chloromethyl)-1,3-thiazol-2-yl]methyl)-1,3-benzothiazole

CAS: 342405-25-8

Versatile small molecule scaffold

• Formula: C₁₂H₉ClN₂S₂
• Purity: Min. 95%
• Molecular weight: 280.8 g/mol