CAS 34241-86-6
:1,3-Bis(1-phenylethenyl)benzene
Description:
1,3-Bis(1-phenylethenyl)benzene, with the CAS number 34241-86-6, is an organic compound characterized by its unique structure, which features two phenylethenyl groups attached to a central benzene ring. This compound is a member of the stilbene family and exhibits properties typical of polyphenyl compounds, including potential applications in organic electronics and materials science due to its conjugated system. It is generally a solid at room temperature and may exhibit a range of physical properties such as melting and boiling points that are influenced by its molecular structure. The compound is likely to be non-polar, making it soluble in organic solvents but insoluble in water. Its reactivity can be attributed to the presence of double bonds, which may participate in various chemical reactions, including polymerization and electrophilic substitution. Additionally, 1,3-Bis(1-phenylethenyl)benzene may exhibit interesting optical properties, making it a candidate for studies in photochemistry and photophysics. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C22H18
InChI:InChI=1S/C22H18/c1-17(19-10-5-3-6-11-19)21-14-9-15-22(16-21)18(2)20-12-7-4-8-13-20/h3-16H,1-2H2
InChI key:InChIKey=YVWBWDZQFGXBOT-UHFFFAOYSA-N
SMILES:C(=C)(C1=CC(C(=C)C2=CC=CC=C2)=CC=C1)C3=CC=CC=C3
Synonyms:- 1,3-Bis(1-phenylvinyl)benzene
- Benzene, 1,3-Bis(1-Phenylethenyl)-
- Benzene, m-bis(1-phenylvinyl)-
- m-Bis(1-Phenylethenyl)benzene
- 1,3-Bis(1-phenylethenyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,3-Bis[(phenyl)-ethenyl]-benzene
CAS:1,3-Bis[(phenyl)-ethenyl]-benzene is a monomer that polymerizes with cationic polymerization to form polystyrene. 1,3-Bis[(phenyl)-ethenyl]-benzene has been shown to form micelles in water and styrene in organic solvents. It is believed to be an activator for styrene polymerization, which is why it is used as a sample preparation agent. 1,3-Bis[(phenyl)-ethenyl]-benzene has been shown to be copolymerized with alkali metal compounds and other monomers such as isoprene. The morphology of the copolymers depends on the type of initiator used. Polystyrenes prepared from 1,3-bis[(phenyl)-ethenyl]benzene have been found to have lower activation energies than those synthesized from styrene alone.Formula:C22H18Purity:Min. 95%Color and Shape:SolidMolecular weight:282.38 g/mol
