CAS 34245-48-2

9-[5-deoxy-2,3-O-(1-methylethylidene)-5-triaza-1,2-dien-2-ium-1-ylpentofuranosyl]-9H-purin-6-amine

Description:

The chemical substance known as "9-[5-deoxy-2,3-O-(1-methylethylidene)-5-triaza-1,2-dien-2-ium-1-ylpentofuranosyl]-9H-purin-6-amine," with the CAS number 34245-48-2, is a complex organic compound that features a purine base structure. This compound is characterized by the presence of a pentofuranosyl moiety, which is a five-membered sugar ring, and a triaza-dienium group, indicating the presence of nitrogen atoms within the structure that contribute to its unique chemical properties. The methylethylidene group suggests a degree of steric hindrance, which may influence the compound's reactivity and interactions with biological systems. The presence of multiple functional groups, including amines and potentially reactive sites, indicates that this compound may participate in various chemical reactions, making it of interest in medicinal chemistry and biochemistry. Its structural complexity suggests potential applications in nucleoside analogs or as a research tool in studying nucleic acid interactions. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic uses.

Formula: C₁₃H₁₇N₈O₃

InChI: InChI=1/C13H17N8O3/c1-13(2)23-8-6(3-19-20-15)22-12(9(8)24-13)21-5-18-7-10(14)16-4-17-11(7)21/h4-6,8-9,12,15H,3H2,1-2H3,(H2,14,16,17)/q+1

SMILES: CC1(C)OC2C(CNN=N)OC(C2O1)n1cnc2c(N)ncnc12

5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine

CAS: 34245-48-2

5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine (5ADeA) is a novel nucleoside with antiretroviral and antitumor activity. It is an activator of the innate immune system, which stimulates the production of cytokines such as TNF-α and IL-1β. This agent also inhibits viral replication by inhibiting viral RNA synthesis through its effect on the enzyme ribonucleotide reductase. 5ADeA monophosphate has been shown to be an effective antiviral against HIV and hepatitis C virus, as well as being active against human papilloma virus and Epstein-Barr virus. 5ADeA is synthesized in high purity and has a CAS number of 34245-48-2.

Formula: C₁₃H₁₆N₈O₃

Purity: Min. 95%

Molecular weight: 332.32 g/mol

Ref: 3D-NA46265