CAS 34246-96-3: 1-Methoxypyrene

Description:1-Methoxypyrene is an organic compound classified as a polycyclic aromatic hydrocarbon (PAH) derivative. It features a methoxy group (-OCH₃) attached to the pyrene structure, which consists of four fused benzene rings. This compound is typically characterized by its hydrophobic nature, making it relatively insoluble in water but soluble in organic solvents. 1-Methoxypyrene exhibits fluorescence properties, which can be utilized in various analytical applications, including environmental monitoring and biological studies. Its molecular structure contributes to its potential as a marker for environmental pollution, particularly in studies related to combustion processes and the presence of PAHs in the environment. Additionally, like many PAHs, 1-methoxypyrene may have implications for human health, as some PAHs are known to be carcinogenic. Therefore, understanding its behavior, stability, and reactivity in different environments is crucial for assessing its environmental impact and potential health risks.

Formula:C₁₇H₁₂O

InChI:InChI=1S/C17H12O/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10H,1H3

InChI key:InChIKey=CPPFVJLHDNOVTN-UHFFFAOYSA-N

SMILES:O(C1=CC=C2C=CC3=CC=CC=4C=CC1=C2C34)C

Synonyms:
1-Hydroxypyrene methyl ether
1-Methoxy-Pyrene
3-Methoxypyrene
Methyl pyren-1-yl ether
Pyrene, 1-Methoxy-
1-Methoxypyrene

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1-METHOXYPYRENE REF: IN-DA00C0D6CAS: 34246-96-3	97%	To inquire	Tue 29 Apr 25
1-Methoxypyrene REF: 54-OR1009517CAS: 34246-96-3	98%	76.00 €~969.00 €	Mon 28 Apr 25
1-Methoxypyrene REF: 3B-M2919CAS: 34246-96-3	>96.0%(GC)	74.00 €~231.00 €	Wed 30 Apr 25
1-Methoxypyrene REF: 10-F498625CAS: 34246-96-3	95.0%	To inquire	Wed 07 May 25
1-Methoxypyrene REF: 3D-JBA24696CAS: 34246-96-3	Min. 95%	- - -	Discontinued product