CAS 34252-44-3
:2-methyl-2H-indazole-3-carboxylic acid
Description:
2-Methyl-2H-indazole-3-carboxylic acid is an organic compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 3-position and a methyl group (-CH3) at the 2-position of the indazole ring. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, and may exhibit moderate stability under standard conditions. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-11-8(9(12)13)6-4-2-3-5-7(6)10-11/h2-5H,1H3,(H,12,13)
SMILES:Cn1c(c2ccccc2n1)C(=O)O
Synonyms:- 2-Methyl-2H-indazole-3-carboxylic acid
- 2H-Indazole-3-carboxylic acid,2-methyl-
- 2-METHYL-2H-INDAZOLE-3-CARBOXYLIC ACID
- 3-Carboxy-2-methyl-2H-indazole
- 2-Methyl-2H-indazole-3-carboxylicacid97%
- 2-Methylindazole-3-carboxylic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
2-Methyl-2H-indazole-3-carboxylic acid
CAS:Formula:C9H8N2O2Purity:95%Color and Shape:SolidMolecular weight:176.17202-Methyl-2H-indazole-3-carboxylic acid
CAS:2-Methyl-2H-indazole-3-carboxylic acidPurity:≥98%Molecular weight:176.175g/mol2-Methyl-2H-indazole-3-carboxylic acid
CAS:2-Methyl-2H-indazole-3-carboxylic acid can be used as a potentially active molecular skeleton for the design and synthesis of biologically active compounds.Formula:C9H8N2O2Purity:99.51%Color and Shape:SolidMolecular weight:176.1752-Methyl-2H-indazole-3-carboxylic Acid
CAS:Controlled ProductFormula:C9H8N2O2Color and Shape:NeatMolecular weight:176.172-Methyl-2H-indazole-3-carboxylic acid
CAS:2-Methyl-2H-indazole-3-carboxylic acidFormula:C9H8N2O2Purity:98%Color and Shape: white to off-white solidMolecular weight:176.17g/mol2-Methylindazole-3-carboxylic Acid
CAS:Controlled ProductApplications A reagent used to synthesize 5-HT2A and 5-HT3 receptor ligands for use in treating CNS-related disorders.
References Bermudez, J., et al.: J. Med. Chem., 33, 1924 (1990),Formula:C9H8N2O2Color and Shape:NeatMolecular weight:176.172-Methyl-2H-indazole-3-carboxylic acid
CAS:Formula:C9H8N2O2Purity:98%Color and Shape:SolidMolecular weight:176.1752-Methylindazole-3-carboxylic acid
CAS:2-Methylindazole-3-carboxylic acid is a potential impurity in the synthesis of granisetron. It is a byproduct of the reaction between methyl iodide and indazole, which is an unreacted material in the synthesis of 2-methylindazole-3-carboxylic acid. The hydrochloride salt form of granisetron can be obtained by reacting granisetron with hydrochloric acid or hydrogen chloride gas in presence of a base such as triethylamine. 2-Methylindazole-3-carboxylic acid may also be recycled from the reaction mixture. In addition, this compound has been found to be present in low yield in a pharmacopeia for granisetron hydrochloride tablets.Formula:C9H8N2O2Purity:Min. 95%Molecular weight:176.17 g/mol









