CymitQuimica logo

CAS 34253-02-6

:

methyl pyridazine-3-carboxylate

Description:
Methyl pyridazine-3-carboxylate is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylate functional group, which contributes to its reactivity and solubility in polar solvents. The methyl group attached to the carboxylate enhances its lipophilicity, making it more soluble in organic solvents. Methyl pyridazine-3-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. The presence of the pyridazine moiety can impart unique biological activities, making it of interest in medicinal chemistry. Additionally, its chemical properties allow for various reactions, including esterification and nucleophilic substitutions, which are valuable in synthetic applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c1-10-6(9)5-3-2-4-7-8-5/h2-4H,1H3
InChI key:ITMAHDJHOXDZEL-UHFFFAOYSA-N
SMILES:COC(=O)c1cccnn1
Synonyms:
  • 3-Pyridazinecarboxylic Acid Methyl Ester
Found 4 products.