CAS 342611-08-9

ethyl 4-amino-2,3,5,6-tetradeuterio-benzoate

Description:

Ethyl 4-amino-2,3,5,6-tetradeuterio-benzoate is a deuterated derivative of ethyl benzoate, where specific hydrogen atoms are replaced with deuterium isotopes. This compound features an ethyl ester functional group attached to a benzene ring that has an amino group at the para position relative to the ester. The presence of deuterium enhances the compound's stability and alters its physical properties, making it useful in various applications, including NMR spectroscopy and tracer studies in chemical and biological research. The amino group contributes to the compound's potential reactivity, allowing for further chemical modifications. Additionally, the deuterated nature of this compound can influence its solubility, boiling point, and other thermodynamic properties compared to its non-deuterated counterparts. Ethyl 4-amino-2,3,5,6-tetradeuterio-benzoate is typically handled with standard laboratory safety precautions, as with other organic compounds, and its applications are primarily in research settings.

Formula: C₉H₇D₄NO₂

InChI: InChI=1/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3/i3D,4D,5D,6D

SMILES: CCOC(=O)c1c(c(c(c(c1[2H])[2H])N)[2H])[2H]

Synonyms:

• Benzoic-2,3,5,6-D< Sub> 4< /Sub> Acid, 4-Amino-, Ethyl Ester
• Ethyl 4-amino(< sup> 2< /sup> H< sub> 4< /sub> )benzoate

Ethyl 4-Aminobenzoate-2,3,5,6-d4

CAS: 342611-08-9

Formula: H₂NC₆D₄COOCH₂CH₃

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 169.10409

Ref: 3U-D1952

Benzocaine-d4

Controlled Product

CAS: 342611-08-9

Applications Labelled Benzocaine (B202970). Benzocaine is used as an anesthetic (local).
References Ali, S.L., et al.: Anal. Profiles Drug Subs., 12, 73 (1983),

Formula: C₉₂H₄H₇NO₂

Color and Shape: Neat

Molecular weight: 169.21

Ref: TR-B197952

Benzocaine-d4

CAS: 342611-08-9

Formula: C₉H₇D₄NO₂

Color and Shape: Solid

Molecular weight: 169.2138

Ref: IN-DA007H0R