CAS 342613-63-2
:Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate
Description:
Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate is a chemical compound characterized by its unique structure, which includes an imidazole ring fused to a pyridine ring, along with a bromine substituent and a carboxylate ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The methyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the imidazo and pyridine moieties may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Overall, Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate is a versatile compound with implications in both synthetic and medicinal chemistry.
Formula:C8H7BrN2O3
InChI:InChI=1/C9H7BrN2O2/c1-14-9(13)6-2-3-12-7(10)5-11-8(12)4-6/h2-5H,1H3
SMILES:COC(=O)c1ccn2c(cnc2c1)Br
Synonyms:- 3-Bromo-imidazo[1,2-a]pyridine-7-carboxylic acid methyl ester
- Methyl3-bromoimidazo[1,2-a]pyridine-7-carboxylate,95%
- Methyl 3-broMoiMidazo[1,2...
- Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate
- methyl 3-bromoH-imidazo[1,2-a]pyridine-7-carboxylate
- 3-Bromo-7-(methoxycarbonyl)imidazo[1,2-a]pyridine
- IMidazo[1,2-a]pyridine-7-carboxylic acid, 3-broMo-, Methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate, 95%
CAS:Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product /Formula:C9H7BrN2O2Purity:95%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:255.07methyl 3-bromoH-imidazo[1,2-a]pyridine-7-carboxylate
CAS:Formula:C9H7BrN2O2Purity:97%Color and Shape:SolidMolecular weight:255.0681Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate
CAS:Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylatePurity:≥95%Color and Shape:Off-White SolidMolecular weight:255.07g/molMethyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate
CAS:Formula:C9H7BrN2O2Purity:97%Color and Shape:SolidMolecular weight:255.071Methyl 3-bromoimidazo[1,2-a]pyridine-7-carboxylate
CAS:Versatile small molecule scaffoldFormula:C9H7BrN2O2Purity:Min. 95%Molecular weight:255.07 g/mol




