CAS 342621-21-0

1-(2-amino-5-chloro-4-triisopropylsilyloxy-phenyl)-2,2,2-trifluoro-ethanone

Description:

1-(2-amino-5-chloro-4-triisopropylsilyloxy-phenyl)-2,2,2-trifluoro-ethanone is a chemical compound characterized by its complex structure, which includes a trifluoroethanone moiety and a phenyl ring substituted with an amino group and a chloro group. The presence of the triisopropylsilyloxy group enhances its stability and solubility in organic solvents, making it useful in various chemical applications. The trifluoroethanone functional group contributes to its reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit unique properties such as increased lipophilicity due to the trifluoromethyl group, which can influence its biological activity and interaction with other molecules. Additionally, the amino and chloro substituents can participate in hydrogen bonding and other intermolecular interactions, potentially affecting its behavior in different environments. Overall, this compound's distinct functional groups and structural features make it a subject of interest in synthetic organic chemistry and materials science.

Formula: C₁₇H₂₅ClF₃NO₂Si

InChI: InChI=1/C17H25ClF3NO2Si/c1-9(2)25(10(3)4,11(5)6)24-15-8-14(22)12(7-13(15)18)16(23)17(19,20)21/h7-11H,22H2,1-6H3

SMILES: CC(C)[Si](C(C)C)(C(C)C)Oc1cc(c(cc1Cl)C(=O)C(F)(F)F)N