CAS 34264-14-7
:1-[4-(prop-2-yn-1-yloxy)phenyl]ethanone
Description:
1-[4-(Prop-2-yn-1-yloxy)phenyl]ethanone, with the CAS number 34264-14-7, is an organic compound characterized by its functional groups and structural features. It contains a phenyl ring substituted with a prop-2-yn-1-yloxy group and an ethanone moiety, indicating the presence of both an ether and a ketone functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the alkyne group suggests that it may participate in various chemical reactions, including cycloadditions and cross-coupling reactions. Additionally, the compound's reactivity can be influenced by the electron-donating or withdrawing nature of the substituents on the phenyl ring. Safety data should be consulted for handling, as organic compounds can vary in toxicity and environmental impact. Overall, 1-[4-(prop-2-yn-1-yloxy)phenyl]ethanone is a versatile compound with significant implications in chemical research and industry.
Formula:C11H10O2
InChI:InChI=1/C11H10O2/c1-3-8-13-11-6-4-10(5-7-11)9(2)12/h1,4-7H,8H2,2H3
SMILES:C#CCOc1ccc(cc1)C(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(4-(Prop-2-yn-1-yloxy)phenyl)ethanone
CAS:Formula:C11H10O2Purity:98%Color and Shape:SolidMolecular weight:174.19591-[4-(Prop-2-yn-1-yloxy)phenyl]ethan-1-one
CAS:1-[4-(Prop-2-yn-1-yloxy)phenyl]ethan-1-onePurity:95%Molecular weight:174.20g/mol1-[4-(2-Propynyloxy)phenyl]-1-ethanone
CAS:1-[4-(2-Propynyloxy)phenyl]-1-ethanone is a quinine derivative with a bathochromic shift. It has been shown to undergo cycloadditions, photophysical, and supramolecular reactions in the presence of other molecules. 1-[4-(2-Propynyloxy)phenyl]-1-ethanone shows luminescent properties under optical microscopy and shifts from red to blue when it is irradiated. The compound can also be used as an optical probe for studying the mechanism of drug release in vitro.
Formula:C11H10O2Purity:Min. 95%Molecular weight:174.2 g/mol



