CAS 34272-67-8

4-Methyl-2-phenyl-5-thiazoleacetic acid

Description:

4-Methyl-2-phenyl-5-thiazoleacetic acid, with the CAS number 34272-67-8, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a phenyl group attached to the thiazole, contributing to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids due to their ability to form hydrogen bonds. The presence of the thiazole moiety suggests potential biological activity, as thiazole derivatives are often explored in medicinal chemistry for their antimicrobial and anti-inflammatory properties. The carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may act as a weak acid. Overall, 4-Methyl-2-phenyl-5-thiazoleacetic acid is of interest in various fields, including pharmaceuticals and organic synthesis, due to its structural features and potential applications.

Formula: C₁₂H₁₁NO₂S

InChI: InChI=1S/C12H11NO2S/c1-8-10(7-11(14)15)16-12(13-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,14,15)

InChI key: InChIKey=RWYONVYVVYSLDV-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1SC(=NC1C)C2=CC=CC=C2

Synonyms:

• (4-Methyl-2-phenyl-thiazol-5-yl)-acetic acid
• 2-(4-Methyl-2-phenyl-1,3-thiazol-5-yl)acetic acid
• 4-Methyl-2-phenyl-5-thiazoleacetic acid
• 5-Thiazoleacetic Acid, 4-Methyl-2-Phenyl-
• (4-Methyl-2-phenyl-1,3-thiazol-5-yl)acetic acid

(4-methyl-2-phenyl-1,3-thiazol-5-yl)acetic acid

CAS: 34272-67-8

Formula: C₁₂H₁₁NO₂S

Purity: 95.0%

Molecular weight: 233.29

Ref: 10-F496138