CymitQuimica logo

CAS 34272-68-9

:

[2-(pyridin-2-yl)-1,3-thiazol-4-yl]acetic acid

Description:
[2-(pyridin-2-yl)-1,3-thiazol-4-yl]acetic acid, with the CAS number 34272-68-9, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid functional group. The presence of the pyridine ring may impart basicity and influence its reactivity, while the thiazole ring contributes to its biological activity and potential pharmacological properties. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as thiazole and pyridine derivatives are often associated with various biological activities. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, [2-(pyridin-2-yl)-1,3-thiazol-4-yl]acetic acid represents a versatile scaffold for further chemical exploration and application.
Formula:C10H8N2O2S
InChI:InChI=1/C10H8N2O2S/c13-9(14)5-7-6-15-10(12-7)8-3-1-2-4-11-8/h1-4,6H,5H2,(H,13,14)
InChI key:GVNODPPFELQGRH-UHFFFAOYSA-N
SMILES:c1ccnc(c1)c1nc(CC(=O)O)cs1
Synonyms:
  • 4-Thiazoleacetic Acid, 2-(2-Pyridinyl)-
  • (2-pyridin-2-yl-1,3-thiazol-4-yl)acetic acid
Found 4 products.