CAS 342789-81-5
:1-n-Butyl-3-methylimidazolium methanesulfonate
Description:
1-n-Butyl-3-methylimidazolium methanesulfonate is an ionic liquid characterized by its unique combination of a bulky butyl group and a methyl-substituted imidazolium cation paired with a methanesulfonate anion. This compound typically exhibits low volatility, high thermal stability, and a wide liquid range, making it suitable for various applications in green chemistry and as a solvent for chemical reactions. Its ionic nature contributes to its excellent solvation properties, allowing it to dissolve a wide range of organic and inorganic compounds. Additionally, it is known for its low toxicity and biodegradability compared to traditional solvents, which enhances its appeal in sustainable practices. The presence of the methanesulfonate anion imparts unique properties, such as enhanced ionic conductivity, which can be beneficial in electrochemical applications. Overall, 1-n-Butyl-3-methylimidazolium methanesulfonate is a versatile compound with significant potential in fields such as catalysis, extraction processes, and energy storage systems.
Formula:C9H18N2O3S
InChI:InChI=1/C8H15N2.CH4O3S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1
Synonyms:- 1-butyl-3-methyl-1H-imidazol-3-ium methanesulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Butyl-3-methylimidazolium Methanesulfonate
CAS:Formula:C9H18N2O3SPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:234.311-n-Butyl-3-methylimidazolium methanesulfonate, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H18N2O3SPurity:99%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:234.311-Butyl-3-methylimidazolium methanesulfonate
CAS:Formula:C9H18N2O3SPurity:95%Color and Shape:SolidMolecular weight:234.31581-Butyl-3-Methylimidazolium Methanesulfonate
CAS:1-Butyl-3-Methylimidazolium MethanesulfonatePurity:99%Molecular weight:234.32g/mol




